Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Polyethyleneimine, branched, M.W. 600, 99%
CAS: 9002-98-6 Molecular Formula: ((C2H5N)zC2H4N)y(C2H5N)x Molecular Weight (g/mol): 43.07 MDL Number: MFCD00084427 InChI Key: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC Name: aziridine SMILES: *-CCNCCN(-*)CCN-*
| PubChem CID | 9033 |
|---|---|
| CAS | 9002-98-6 |
| Molecular Weight (g/mol) | 43.07 |
| ChEBI | CHEBI:30969 |
| MDL Number | MFCD00084427 |
| SMILES | *-CCNCCN(-*)CCN-* |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| IUPAC Name | aziridine |
| InChI Key | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molecular Formula | ((C2H5N)zC2H4N)y(C2H5N)x |
2-Iodobenzoyl chloride, 98%
CAS: 609-67-6 Molecular Formula: C7H4ClIO Molecular Weight (g/mol): 266.462 MDL Number: MFCD00001040 InChI Key: MVIVDSWUOGNODP-UHFFFAOYSA-N PubChem CID: 69112 IUPAC Name: 2-iodobenzoyl chloride SMILES: C1=CC=C(C(=C1)C(=O)Cl)I
| PubChem CID | 69112 |
|---|---|
| CAS | 609-67-6 |
| Molecular Weight (g/mol) | 266.462 |
| MDL Number | MFCD00001040 |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)I |
| IUPAC Name | 2-iodobenzoyl chloride |
| InChI Key | MVIVDSWUOGNODP-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClIO |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |
Borane-2-methylpyridine complex, 95%
CAS: 3999-38-0 Molecular Formula: C6H10BN Molecular Weight (g/mol): 106.96 MDL Number: MFCD07784361 InChI Key: ZMASBEFBIXMNCP-UHFFFAOYSA-N Synonym: 2-Picoline borane complex IUPAC Name: 2-methylpyridine borane SMILES: B.CC1=CC=CC=N1
| CAS | 3999-38-0 |
|---|---|
| Molecular Weight (g/mol) | 106.96 |
| MDL Number | MFCD07784361 |
| SMILES | B.CC1=CC=CC=N1 |
| Synonym | 2-Picoline borane complex |
| IUPAC Name | 2-methylpyridine borane |
| InChI Key | ZMASBEFBIXMNCP-UHFFFAOYSA-N |
| Molecular Formula | C6H10BN |
Polyethylene glycol monomethylether, 350
CAS: 9004-74-4 Molecular Formula: (C2H4O)nCH4O Molecular Weight (g/mol): 76.10 MDL Number: MFCD00084416 InChI Key: XNWFRZJHXBZDAG-UHFFFAOYSA-N Synonym: methyl cellosolve,ethanol, 2-methoxy,ethylene glycol monomethyl ether,methyl oxitol,2-methoxy-1-ethanol,methoxyethanol,3-oxa-1-butanol,egme,monomethyl glycol,dowanol em PubChem CID: 8019 ChEBI: CHEBI:46790 IUPAC Name: 2-methoxyethanol SMILES: COCCO
| PubChem CID | 8019 |
|---|---|
| CAS | 9004-74-4 |
| Molecular Weight (g/mol) | 76.10 |
| ChEBI | CHEBI:46790 |
| MDL Number | MFCD00084416 |
| SMILES | COCCO |
| Synonym | methyl cellosolve,ethanol, 2-methoxy,ethylene glycol monomethyl ether,methyl oxitol,2-methoxy-1-ethanol,methoxyethanol,3-oxa-1-butanol,egme,monomethyl glycol,dowanol em |
| IUPAC Name | 2-methoxyethanol |
| InChI Key | XNWFRZJHXBZDAG-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)nCH4O |
Lanolin, Thermo Scientific Chemicals
CAS: 8006-54-0 MDL Number: MFCD00081740 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
| CAS | 8006-54-0 |
|---|---|
| MDL Number | MFCD00081740 |
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |
1-Pentanol, ACS, 98+%
CAS: 71-41-0 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00002977,MFCD00081734,MFCD01075169 InChI Key: AMQJEAYHLZJPGS-UHFFFAOYSA-N Synonym: 1-pentanol,amyl alcohol,n-amyl alcohol,n-pentanol,pentanol,pentyl alcohol,butylcarbinol,1-pentyl alcohol,amylol,n-butylcarbinol PubChem CID: 6276 ChEBI: CHEBI:44884 IUPAC Name: pentan-1-ol SMILES: CCCCCO
| PubChem CID | 6276 |
|---|---|
| CAS | 71-41-0 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:44884 |
| MDL Number | MFCD00002977,MFCD00081734,MFCD01075169 |
| SMILES | CCCCCO |
| Synonym | 1-pentanol,amyl alcohol,n-amyl alcohol,n-pentanol,pentanol,pentyl alcohol,butylcarbinol,1-pentyl alcohol,amylol,n-butylcarbinol |
| IUPAC Name | pentan-1-ol |
| InChI Key | AMQJEAYHLZJPGS-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
p-Anisidine, 99%
CAS: 104-94-9 Molecular Formula: C7H9NO Molecular Weight (g/mol): 123.15 MDL Number: MFCD00007864 InChI Key: BHAAPTBBJKJZER-UHFFFAOYSA-N Synonym: p-anisidine,4-anisidine,4-methoxybenzenamine,4-aminoanisole,p-aminoanisole,para-anisidine,p-methoxyaniline,benzenamine, 4-methoxy,4-methoxybenzeneamine,p-anisylamine PubChem CID: 7732 ChEBI: CHEBI:82388 IUPAC Name: 4-methoxyaniline SMILES: COC1=CC=C(C=C1)N
| PubChem CID | 7732 |
|---|---|
| CAS | 104-94-9 |
| Molecular Weight (g/mol) | 123.15 |
| ChEBI | CHEBI:82388 |
| MDL Number | MFCD00007864 |
| SMILES | COC1=CC=C(C=C1)N |
| Synonym | p-anisidine,4-anisidine,4-methoxybenzenamine,4-aminoanisole,p-aminoanisole,para-anisidine,p-methoxyaniline,benzenamine, 4-methoxy,4-methoxybenzeneamine,p-anisylamine |
| IUPAC Name | 4-methoxyaniline |
| InChI Key | BHAAPTBBJKJZER-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO |
6-Thioguanine, 98%
CAS: 154-42-7 Molecular Formula: C5H5N5S Molecular Weight (g/mol): 167.19 MDL Number: MFCD00233553 InChI Key: WYWHKKSPHMUBEB-UHFFFAOYSA-N Synonym: 6-thioguanine,thioguanine,tioguanine,2-amino-6-mercaptopurine,6-mercaptoguanine,tioguanin,tabloid,lanvis,2-amino-6-purinethiol,2-aminopurine-6-thiol PubChem CID: 2723601 ChEBI: CHEBI:9555 SMILES: NC1=NC(=S)C2=C(N1)N=CN2
| PubChem CID | 2723601 |
|---|---|
| CAS | 154-42-7 |
| Molecular Weight (g/mol) | 167.19 |
| ChEBI | CHEBI:9555 |
| MDL Number | MFCD00233553 |
| SMILES | NC1=NC(=S)C2=C(N1)N=CN2 |
| Synonym | 6-thioguanine,thioguanine,tioguanine,2-amino-6-mercaptopurine,6-mercaptoguanine,tioguanin,tabloid,lanvis,2-amino-6-purinethiol,2-aminopurine-6-thiol |
| InChI Key | WYWHKKSPHMUBEB-UHFFFAOYSA-N |
| Molecular Formula | C5H5N5S |
Styrene, 99%, stab. with 10-15ppm 4-tert-butylcatechol
CAS: 100-42-5 Molecular Formula: C8H8 Molecular Weight (g/mol): 104.15 MDL Number: MFCD00008612,MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 SMILES: C=CC1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 100-42-5 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00008612,MFCD00084450 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | C8H8 |
4'-Methoxyacetophenone, 99%
CAS: 100-06-1 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00008745 InChI Key: NTPLXRHDUXRPNE-UHFFFAOYSA-N Synonym: 4'-methoxyacetophenone,4-acetylanisole,4-methoxyacetophenone,1-4-methoxyphenyl ethanone,p-methoxyacetophenone,acetanisole,novatone,linarodin,vananote,ethanone, 1-4-methoxyphenyl PubChem CID: 7476 ChEBI: CHEBI:86567 IUPAC Name: 1-(4-methoxyphenyl)ethanone SMILES: COC1=CC=C(C=C1)C(C)=O
| PubChem CID | 7476 |
|---|---|
| CAS | 100-06-1 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:86567 |
| MDL Number | MFCD00008745 |
| SMILES | COC1=CC=C(C=C1)C(C)=O |
| Synonym | 4'-methoxyacetophenone,4-acetylanisole,4-methoxyacetophenone,1-4-methoxyphenyl ethanone,p-methoxyacetophenone,acetanisole,novatone,linarodin,vananote,ethanone, 1-4-methoxyphenyl |
| IUPAC Name | 1-(4-methoxyphenyl)ethanone |
| InChI Key | NTPLXRHDUXRPNE-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Methoxybenzyl alcohol, 98%
CAS: 105-13-5 Molecular Formula: C8H10O2 Molecular Weight (g/mol): 138.17 MDL Number: MFCD00004653 InChI Key: MSHFRERJPWKJFX-UHFFFAOYSA-N Synonym: 4-methoxybenzyl alcohol,4-methoxyphenyl methanol,anise alcohol,anisyl alcohol,p-anisyl alcohol,p-methoxybenzyl alcohol,benzenemethanol, 4-methoxy,anisic alcohol,p-anisol alcohol,4-methoxybenzenemethanol PubChem CID: 7738 ChEBI: CHEBI:86918 IUPAC Name: (4-methoxyphenyl)methanol SMILES: COC1=CC=C(CO)C=C1
| PubChem CID | 7738 |
|---|---|
| CAS | 105-13-5 |
| Molecular Weight (g/mol) | 138.17 |
| ChEBI | CHEBI:86918 |
| MDL Number | MFCD00004653 |
| SMILES | COC1=CC=C(CO)C=C1 |
| Synonym | 4-methoxybenzyl alcohol,4-methoxyphenyl methanol,anise alcohol,anisyl alcohol,p-anisyl alcohol,p-methoxybenzyl alcohol,benzenemethanol, 4-methoxy,anisic alcohol,p-anisol alcohol,4-methoxybenzenemethanol |
| IUPAC Name | (4-methoxyphenyl)methanol |
| InChI Key | MSHFRERJPWKJFX-UHFFFAOYSA-N |
| Molecular Formula | C8H10O2 |
Quinoline, 96%
CAS: 91-22-5 Molecular Formula: C9H7N Molecular Weight (g/mol): 129.16 MDL Number: MFCD00006736,MFCD06637409,MFCD31699982,MFCD31699983,MFCD31699984,MFCD31699985,MFCD31699986,MFCD31699987 InChI Key: SMWDFEZZVXVKRB-UHFFFAOYSA-N Synonym: chinolin,chinoline,1-benzazine,quinolin,1-azanaphthalene,chinoleine,leucol,benzo b pyridine,benzopyridine,leukol PubChem CID: 7047 ChEBI: CHEBI:17362 IUPAC Name: quinoline SMILES: C1=CC=C2N=CC=CC2=C1
| PubChem CID | 7047 |
|---|---|
| CAS | 91-22-5 |
| Molecular Weight (g/mol) | 129.16 |
| ChEBI | CHEBI:17362 |
| MDL Number | MFCD00006736,MFCD06637409,MFCD31699982,MFCD31699983,MFCD31699984,MFCD31699985,MFCD31699986,MFCD31699987 |
| SMILES | C1=CC=C2N=CC=CC2=C1 |
| Synonym | chinolin,chinoline,1-benzazine,quinolin,1-azanaphthalene,chinoleine,leucol,benzo b pyridine,benzopyridine,leukol |
| IUPAC Name | quinoline |
| InChI Key | SMWDFEZZVXVKRB-UHFFFAOYSA-N |
| Molecular Formula | C9H7N |
Tris(2-carboxyethyl)phosphine hydrochloride, 95%, 0.5M soln. in water
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Benzyl bromide, 98%
CAS: 100-39-0 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |